About N-[2-[(2,4,6-trichlorophenyl)hydrazinylidene]propylidene]hydroxylamine
N-[2-[(2,4,6-trichlorophenyl)hydrazinylidene]propylidene]hydroxylamine (PubChem CID 135456479) has the molecular formula C9H8Cl3N3O
and a molecular weight of 280.54 g/mol. Its IUPAC name is N-[2-[(2,4,6-trichlorophenyl)hydrazinylidene]propylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[2-[(2,4,6-trichlorophenyl)hydrazinylidene]propylidene]hydroxylamine |
| PubChem CID | 135456479 |
| Molecular Formula | C9H8Cl3N3O |
| Molecular Weight | 280.54 g/mol |
| Exact Mass | 278.97 |
| IUPAC Name | N-[2-[(2,4,6-trichlorophenyl)hydrazinylidene]propylidene]hydroxylamine |
| SMILES | CC(C=NO)=NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl3N3O/c1-5(4-13-16)14-15-9-7(11)2-6(10)3-8(9)12/h2-4,15-16H,1H3 |
| InChIKey | GUCLHJDRRVAKLB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(2,4,6-trichlorophenyl)hydrazinylidene]propylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2,4,6-trichlorophenyl)hydrazinylidene]propylidene]hydroxylamine?
The IUPAC name of N-[2-[(2,4,6-trichlorophenyl)hydrazinylidene]propylidene]hydroxylamine (CID 135456479) is N-[2-[(2,4,6-trichlorophenyl)hydrazinylidene]propylidene]hydroxylamine.
What is the SMILES notation for N-[2-[(2,4,6-trichlorophenyl)hydrazinylidene]propylidene]hydroxylamine?
The canonical SMILES for N-[2-[(2,4,6-trichlorophenyl)hydrazinylidene]propylidene]hydroxylamine is CC(C=NO)=NNc1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of N-[2-[(2,4,6-trichlorophenyl)hydrazinylidene]propylidene]hydroxylamine?
The InChIKey is GUCLHJDRRVAKLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl3N3O/c1-5(4-13-16)14-15-9-7(11)2-6(10)3-8(9)12/h2-4,15-16H,1H3.
What are the key properties of N-[2-[(2,4,6-trichlorophenyl)hydrazinylidene]propylidene]hydroxylamine?
N-[2-[(2,4,6-trichlorophenyl)hydrazinylidene]propylidene]hydroxylamine has a molecular weight of 280.54 g/mol, XLogP of 3.89, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2,4,6-trichlorophenyl)hydrazinylidene]propylidene]hydroxylamine is sourced from PubChem (CID 135456479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).