About 3-pyridin-3-yl-4H-1,2,4-oxadiazol-5-one
3-pyridin-3-yl-4H-1,2,4-oxadiazol-5-one (PubChem CID 135456618) has the molecular formula C7H5N3O2
and a molecular weight of 163.14 g/mol. Its IUPAC name is 3-pyridin-3-yl-4H-1,2,4-oxadiazol-5-one.
Molecular Properties
| Compound Name | 3-pyridin-3-yl-4H-1,2,4-oxadiazol-5-one |
| PubChem CID | 135456618 |
| Molecular Formula | C7H5N3O2 |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 3-pyridin-3-yl-4H-1,2,4-oxadiazol-5-one |
| SMILES | O=c1[nH]c(-c2cccnc2)no1 |
| InChI | InChI=1S/C7H5N3O2/c11-7-9-6(10-12-7)5-2-1-3-8-4-5/h1-4H,(H,9,10,11) |
| InChIKey | XSSFIDOWUWMEBD-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-pyridin-3-yl-4H-1,2,4-oxadiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-3-yl-4H-1,2,4-oxadiazol-5-one?
The IUPAC name of 3-pyridin-3-yl-4H-1,2,4-oxadiazol-5-one (CID 135456618) is 3-pyridin-3-yl-4H-1,2,4-oxadiazol-5-one.
What is the SMILES notation for 3-pyridin-3-yl-4H-1,2,4-oxadiazol-5-one?
The canonical SMILES for 3-pyridin-3-yl-4H-1,2,4-oxadiazol-5-one is O=c1[nH]c(-c2cccnc2)no1.
What is the InChIKey of 3-pyridin-3-yl-4H-1,2,4-oxadiazol-5-one?
The InChIKey is XSSFIDOWUWMEBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2/c11-7-9-6(10-12-7)5-2-1-3-8-4-5/h1-4H,(H,9,10,11).
What are the key properties of 3-pyridin-3-yl-4H-1,2,4-oxadiazol-5-one?
3-pyridin-3-yl-4H-1,2,4-oxadiazol-5-one has a molecular weight of 163.14 g/mol, XLogP of 0.42, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-3-yl-4H-1,2,4-oxadiazol-5-one is sourced from PubChem (CID 135456618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).