About 7-fluoro-3H-pyrido[4,3-d]pyrimidin-4-one
7-fluoro-3H-pyrido[4,3-d]pyrimidin-4-one (PubChem CID 135456619) has the molecular formula C7H4FN3O
and a molecular weight of 165.13 g/mol. Its IUPAC name is 7-fluoro-3H-pyrido[4,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-fluoro-3H-pyrido[4,3-d]pyrimidin-4-one |
| PubChem CID | 135456619 |
| Molecular Formula | C7H4FN3O |
| Molecular Weight | 165.13 g/mol |
| Exact Mass | 165.03 |
| IUPAC Name | 7-fluoro-3H-pyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2cc(F)ncc12 |
| InChI | InChI=1S/C7H4FN3O/c8-6-1-5-4(2-9-6)7(12)11-3-10-5/h1-3H,(H,10,11,12) |
| InChIKey | LWRUMQJSJBZUCC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.13 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-3H-pyrido[4,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-3H-pyrido[4,3-d]pyrimidin-4-one?
The IUPAC name of 7-fluoro-3H-pyrido[4,3-d]pyrimidin-4-one (CID 135456619) is 7-fluoro-3H-pyrido[4,3-d]pyrimidin-4-one.
What is the SMILES notation for 7-fluoro-3H-pyrido[4,3-d]pyrimidin-4-one?
The canonical SMILES for 7-fluoro-3H-pyrido[4,3-d]pyrimidin-4-one is O=c1[nH]cnc2cc(F)ncc12.
What is the InChIKey of 7-fluoro-3H-pyrido[4,3-d]pyrimidin-4-one?
The InChIKey is LWRUMQJSJBZUCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FN3O/c8-6-1-5-4(2-9-6)7(12)11-3-10-5/h1-3H,(H,10,11,12).
What are the key properties of 7-fluoro-3H-pyrido[4,3-d]pyrimidin-4-one?
7-fluoro-3H-pyrido[4,3-d]pyrimidin-4-one has a molecular weight of 165.13 g/mol, XLogP of 0.46, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-3H-pyrido[4,3-d]pyrimidin-4-one is sourced from PubChem (CID 135456619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).