C24H19F2N3O2S — CID 135456852
5-(4-fluorophenyl)-2-[(2-fluorophenyl)methylsulfanyl]-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135456852) has the molecular formula C24H19F2N3O2S and a molecular weight of 451.50 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-[(2-fluorophenyl)methylsulfanyl]-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 5-(4-fluorophenyl)-2-[(2-fluorophenyl)methylsulfanyl]-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135456852 |
| Molecular Formula | C24H19F2N3O2S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 5-(4-fluorophenyl)-2-[(2-fluorophenyl)methylsulfanyl]-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | O=C1CCCC2=C1C(c1ccc(F)cc1)c1c(nc(SCc3ccccc3F)[nH]c1=O)N2 |
| InChI | InChI=1S/C24H19F2N3O2S/c25-15-10-8-13(9-11-15)19-20-17(6-3-7-18(20)30)27-22-21(19)23(31)29-24(28-22)32-12-14-4-1-2-5-16(14)26/h1-2,4-5,8-11,19H,3,6-7,12H2,(H2,27,28,29,31) |
| InChIKey | GQLRWAWLNKMJHJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |