C15H20N4 — CID 135456863
1-phenyl-N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)pyrazolidin-3-imine (PubChem CID 135456863) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-phenyl-N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)pyrazolidin-3-imine.
| Compound Name | 1-phenyl-N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)pyrazolidin-3-imine |
|---|---|
| PubChem CID | 135456863 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 1-phenyl-N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)pyrazolidin-3-imine |
| SMILES | c1ccc(N2CC/C(=N\C3=NCCCCC3)N2)cc1 |
| InChI | InChI=1S/C15H20N4/c1-3-7-13(8-4-1)19-12-10-15(18-19)17-14-9-5-2-6-11-16-14/h1,3-4,7-8H,2,5-6,9-12H2,(H,16,17,18) |
| InChIKey | JQFWBVSMWRKTMN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|