About 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-fluorobenzoate
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-fluorobenzoate (PubChem CID 135456869) has the molecular formula C16H13FN2O4S
and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-fluorobenzoate.
Molecular Properties
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-fluorobenzoate |
| PubChem CID | 135456869 |
| Molecular Formula | C16H13FN2O4S |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-fluorobenzoate |
| SMILES | O=C(OCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H13FN2O4S/c17-12-7-5-11(6-8-12)16(20)23-10-9-18-15-13-3-1-2-4-14(13)24(21,22)19-15/h1-8H,9-10H2,(H,18,19) |
| InChIKey | MYLSIDFLAJQEAL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-fluorobenzoate?
The IUPAC name of 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-fluorobenzoate (CID 135456869) is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-fluorobenzoate.
What is the SMILES notation for 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-fluorobenzoate?
The canonical SMILES for 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-fluorobenzoate is O=C(OCC/N=C1\NS(=O)(=O)c2ccccc21)c1ccc(F)cc1.
What is the InChIKey of 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-fluorobenzoate?
The InChIKey is MYLSIDFLAJQEAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN2O4S/c17-12-7-5-11(6-8-12)16(20)23-10-9-18-15-13-3-1-2-4-14(13)24(21,22)19-15/h1-8H,9-10H2,(H,18,19).
What are the key properties of 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-fluorobenzoate?
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-fluorobenzoate has a molecular weight of 348.36 g/mol, XLogP of 1.72, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-fluorobenzoate is sourced from PubChem (CID 135456869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).