C16H14N2O4S — CID 135457068
2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-4-(methoxymethyl)-1H-pyrimidin-6-one (PubChem CID 135457068) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-4-(methoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-4-(methoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135457068 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-[2-(1-benzofuran-2-yl)-2-oxoethyl]sulfanyl-4-(methoxymethyl)-1H-pyrimidin-6-one |
| SMILES | COCc1cc(=O)[nH]c(SCC(=O)c2cc3ccccc3o2)n1 |
| InChI | InChI=1S/C16H14N2O4S/c1-21-8-11-7-15(20)18-16(17-11)23-9-12(19)14-6-10-4-2-3-5-13(10)22-14/h2-7H,8-9H2,1H3,(H,17,18,20) |
| InChIKey | PTFUZIPDJQIGOW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |