C22H28N4S — CID 135457247
5-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-(2-methylcyclohexyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135457247) has the molecular formula C22H28N4S and a molecular weight of 380.56 g/mol. Its IUPAC name is 5-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-(2-methylcyclohexyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-(2-methylcyclohexyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135457247 |
| Molecular Formula | C22H28N4S |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 5-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-(2-methylcyclohexyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | Cc1cc(C2=NN/C(=N/C3CCCCC3C)SC2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C22H28N4S/c1-15-9-7-8-12-20(15)23-22-25-24-21(14-27-22)19-13-16(2)26(17(19)3)18-10-5-4-6-11-18/h4-6,10-11,13,15,20H,7-9,12,14H2,1-3H3,(H,23,25) |
| InChIKey | LCGBEPRTRWESGF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|