About 4-chloro-6-[4-(4-methylpiperazin-1-yl)-1H-pyrazol-5-yl]benzene-1,3-diol
4-chloro-6-[4-(4-methylpiperazin-1-yl)-1H-pyrazol-5-yl]benzene-1,3-diol (PubChem CID 135457293) has the molecular formula C14H17ClN4O2
and a molecular weight of 308.77 g/mol. Its IUPAC name is 4-chloro-6-[4-(4-methylpiperazin-1-yl)-1H-pyrazol-5-yl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-chloro-6-[4-(4-methylpiperazin-1-yl)-1H-pyrazol-5-yl]benzene-1,3-diol |
| PubChem CID | 135457293 |
| Molecular Formula | C14H17ClN4O2 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 4-chloro-6-[4-(4-methylpiperazin-1-yl)-1H-pyrazol-5-yl]benzene-1,3-diol |
| SMILES | CN1CCN(c2cn[nH]c2-c2cc(Cl)c(O)cc2O)CC1 |
| InChI | InChI=1S/C14H17ClN4O2/c1-18-2-4-19(5-3-18)11-8-16-17-14(11)9-6-10(15)13(21)7-12(9)20/h6-8,20-21H,2-5H2,1H3,(H,16,17) |
| InChIKey | GHMAZENTGRQLFA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-6-[4-(4-methylpiperazin-1-yl)-1H-pyrazol-5-yl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-[4-(4-methylpiperazin-1-yl)-1H-pyrazol-5-yl]benzene-1,3-diol?
The IUPAC name of 4-chloro-6-[4-(4-methylpiperazin-1-yl)-1H-pyrazol-5-yl]benzene-1,3-diol (CID 135457293) is 4-chloro-6-[4-(4-methylpiperazin-1-yl)-1H-pyrazol-5-yl]benzene-1,3-diol.
What is the SMILES notation for 4-chloro-6-[4-(4-methylpiperazin-1-yl)-1H-pyrazol-5-yl]benzene-1,3-diol?
The canonical SMILES for 4-chloro-6-[4-(4-methylpiperazin-1-yl)-1H-pyrazol-5-yl]benzene-1,3-diol is CN1CCN(c2cn[nH]c2-c2cc(Cl)c(O)cc2O)CC1.
What is the InChIKey of 4-chloro-6-[4-(4-methylpiperazin-1-yl)-1H-pyrazol-5-yl]benzene-1,3-diol?
The InChIKey is GHMAZENTGRQLFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClN4O2/c1-18-2-4-19(5-3-18)11-8-16-17-14(11)9-6-10(15)13(21)7-12(9)20/h6-8,20-21H,2-5H2,1H3,(H,16,17).
What are the key properties of 4-chloro-6-[4-(4-methylpiperazin-1-yl)-1H-pyrazol-5-yl]benzene-1,3-diol?
4-chloro-6-[4-(4-methylpiperazin-1-yl)-1H-pyrazol-5-yl]benzene-1,3-diol has a molecular weight of 308.77 g/mol, XLogP of 1.89, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-[4-(4-methylpiperazin-1-yl)-1H-pyrazol-5-yl]benzene-1,3-diol is sourced from PubChem (CID 135457293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).