C18H13ClF3N5O — CID 135457874
(5E)-7-chloro-5-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]-2,3,4,10-tetrahydroazepino[3,4-b]indol-1-one (PubChem CID 135457874) has the molecular formula C18H13ClF3N5O and a molecular weight of 407.78 g/mol. Its IUPAC name is (5E)-7-chloro-5-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]-2,3,4,10-tetrahydroazepino[3,4-b]indol-1-one.
| Compound Name | (5E)-7-chloro-5-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]-2,3,4,10-tetrahydroazepino[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 135457874 |
| Molecular Formula | C18H13ClF3N5O |
| Molecular Weight | 407.78 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (5E)-7-chloro-5-[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]-2,3,4,10-tetrahydroazepino[3,4-b]indol-1-one |
| SMILES | O=C1NCC/C(=N\Nc2ccc(C(F)(F)F)cn2)c2c1[nH]c1ccc(Cl)cc21 |
| InChI | InChI=1S/C18H13ClF3N5O/c19-10-2-3-12-11(7-10)15-13(5-6-23-17(28)16(15)25-12)26-27-14-4-1-9(8-24-14)18(20,21)22/h1-4,7-8,25H,5-6H2,(H,23,28)(H,24,27)/b26-13+ |
| InChIKey | IOOSJTXJIHIVRD-LGJNPRDNSA-N |
| XLogP | 4.18 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.78 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|