About 5-(8-chloro-3H-imidazo[4,5-c]quinolin-2-yl)-3-methyl-1,2-oxazole
5-(8-chloro-3H-imidazo[4,5-c]quinolin-2-yl)-3-methyl-1,2-oxazole (PubChem CID 135457984) has the molecular formula C14H9ClN4O
and a molecular weight of 284.71 g/mol. Its IUPAC name is 5-(8-chloro-3H-imidazo[4,5-c]quinolin-2-yl)-3-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(8-chloro-3H-imidazo[4,5-c]quinolin-2-yl)-3-methyl-1,2-oxazole |
| PubChem CID | 135457984 |
| Molecular Formula | C14H9ClN4O |
| Molecular Weight | 284.71 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 5-(8-chloro-3H-imidazo[4,5-c]quinolin-2-yl)-3-methyl-1,2-oxazole |
| SMILES | Cc1cc(-c2nc3c(cnc4ccc(Cl)cc43)[nH]2)on1 |
| InChI | InChI=1S/C14H9ClN4O/c1-7-4-12(20-19-7)14-17-11-6-16-10-3-2-8(15)5-9(10)13(11)18-14/h2-6H,1H3,(H,17,18) |
| InChIKey | OCUULLYDJQVOQF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.71 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(8-chloro-3H-imidazo[4,5-c]quinolin-2-yl)-3-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(8-chloro-3H-imidazo[4,5-c]quinolin-2-yl)-3-methyl-1,2-oxazole?
The IUPAC name of 5-(8-chloro-3H-imidazo[4,5-c]quinolin-2-yl)-3-methyl-1,2-oxazole (CID 135457984) is 5-(8-chloro-3H-imidazo[4,5-c]quinolin-2-yl)-3-methyl-1,2-oxazole.
What is the SMILES notation for 5-(8-chloro-3H-imidazo[4,5-c]quinolin-2-yl)-3-methyl-1,2-oxazole?
The canonical SMILES for 5-(8-chloro-3H-imidazo[4,5-c]quinolin-2-yl)-3-methyl-1,2-oxazole is Cc1cc(-c2nc3c(cnc4ccc(Cl)cc43)[nH]2)on1.
What is the InChIKey of 5-(8-chloro-3H-imidazo[4,5-c]quinolin-2-yl)-3-methyl-1,2-oxazole?
The InChIKey is OCUULLYDJQVOQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClN4O/c1-7-4-12(20-19-7)14-17-11-6-16-10-3-2-8(15)5-9(10)13(11)18-14/h2-6H,1H3,(H,17,18).
What are the key properties of 5-(8-chloro-3H-imidazo[4,5-c]quinolin-2-yl)-3-methyl-1,2-oxazole?
5-(8-chloro-3H-imidazo[4,5-c]quinolin-2-yl)-3-methyl-1,2-oxazole has a molecular weight of 284.71 g/mol, XLogP of 3.73, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(8-chloro-3H-imidazo[4,5-c]quinolin-2-yl)-3-methyl-1,2-oxazole is sourced from PubChem (CID 135457984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).