C12H10N4O5 — CID 135457992
5,10-dihydroxy-2-(hydroxymethyl)-7-methyl-3,8-dihydropyrimido[4,5-g]quinazoline-4,9-dione (PubChem CID 135457992) has the molecular formula C12H10N4O5 and a molecular weight of 290.24 g/mol. Its IUPAC name is 5,10-dihydroxy-2-(hydroxymethyl)-7-methyl-3,8-dihydropyrimido[4,5-g]quinazoline-4,9-dione.
| Compound Name | 5,10-dihydroxy-2-(hydroxymethyl)-7-methyl-3,8-dihydropyrimido[4,5-g]quinazoline-4,9-dione |
|---|---|
| PubChem CID | 135457992 |
| Molecular Formula | C12H10N4O5 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 5,10-dihydroxy-2-(hydroxymethyl)-7-methyl-3,8-dihydropyrimido[4,5-g]quinazoline-4,9-dione |
| SMILES | Cc1nc2c(O)c3c(=O)[nH]c(CO)nc3c(O)c2c(=O)[nH]1 |
| InChI | InChI=1S/C12H10N4O5/c1-3-13-7-5(11(20)14-3)10(19)8-6(9(7)18)12(21)16-4(2-17)15-8/h17-19H,2H2,1H3,(H,13,14,20)(H,15,16,21) |
| InChIKey | OCDSAORCSGLXDA-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 152.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|