C16H16N6 — CID 135457998
5-butyl-8-phenyl-1H-[1,2,4]triazolo[5,1-f]purine (PubChem CID 135457998) has the molecular formula C16H16N6 and a molecular weight of 292.35 g/mol. Its IUPAC name is 5-butyl-8-phenyl-1H-[1,2,4]triazolo[5,1-f]purine.
| Compound Name | 5-butyl-8-phenyl-1H-[1,2,4]triazolo[5,1-f]purine |
|---|---|
| PubChem CID | 135457998 |
| Molecular Formula | C16H16N6 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 5-butyl-8-phenyl-1H-[1,2,4]triazolo[5,1-f]purine |
| SMILES | CCCCc1nc2nc[nH]c2c2nc(-c3ccccc3)nn12 |
| InChI | InChI=1S/C16H16N6/c1-2-3-9-12-19-15-13(17-10-18-15)16-20-14(21-22(12)16)11-7-5-4-6-8-11/h4-8,10H,2-3,9H2,1H3,(H,17,18) |
| InChIKey | LTQQXOYFDPLYHI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |