C17H17N5O3 — CID 135458340
3-[(4-anilino-1,2,5-oxadiazol-3-yl)amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 135458340) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is 3-[(4-anilino-1,2,5-oxadiazol-3-yl)amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[(4-anilino-1,2,5-oxadiazol-3-yl)amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 135458340 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 3-[(4-anilino-1,2,5-oxadiazol-3-yl)amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(Nc2nonc2Nc2ccccc2)c1O |
| InChI | InChI=1S/C17H17N5O3/c1-22(2)17(24)12-9-6-10-13(14(12)23)19-16-15(20-25-21-16)18-11-7-4-3-5-8-11/h3-10,23H,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | BTKVIAUIGSHNSS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|