C22H25N5O3 — CID 135458351
[2-hydroxy-3-[[4-[[(1R)-1-phenylpropyl]amino]-1,2,5-oxadiazol-3-yl]amino]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 135458351) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is [2-hydroxy-3-[[4-[[(1R)-1-phenylpropyl]amino]-1,2,5-oxadiazol-3-yl]amino]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [2-hydroxy-3-[[4-[[(1R)-1-phenylpropyl]amino]-1,2,5-oxadiazol-3-yl]amino]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 135458351 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | [2-hydroxy-3-[[4-[[(1R)-1-phenylpropyl]amino]-1,2,5-oxadiazol-3-yl]amino]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | CC[C@@H](Nc1nonc1Nc1cccc(C(=O)N2CCCC2)c1O)c1ccccc1 |
| InChI | InChI=1S/C22H25N5O3/c1-2-17(15-9-4-3-5-10-15)23-20-21(26-30-25-20)24-18-12-8-11-16(19(18)28)22(29)27-13-6-7-14-27/h3-5,8-12,17,28H,2,6-7,13-14H2,1H3,(H,23,25)(H,24,26)/t17-/m1/s1 |
| InChIKey | YBKULEITLQTHLF-QGZVFWFLSA-N |
| XLogP | 4.32 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|