About 5-chloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine
5-chloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine (PubChem CID 135458392) has the molecular formula C10H12ClN3
and a molecular weight of 209.68 g/mol. Its IUPAC name is 5-chloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine.
Molecular Properties
| Compound Name | 5-chloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine |
| PubChem CID | 135458392 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 5-chloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine |
| SMILES | C/N=C1/Nc2cccc(Cl)c2C(C)N1 |
| InChI | InChI=1S/C10H12ClN3/c1-6-9-7(11)4-3-5-8(9)14-10(12-2)13-6/h3-6H,1-2H3,(H2,12,13,14) |
| InChIKey | OVCRQVHRSLIVTD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine?
The IUPAC name of 5-chloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine (CID 135458392) is 5-chloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine.
What is the SMILES notation for 5-chloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine?
The canonical SMILES for 5-chloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine is C/N=C1/Nc2cccc(Cl)c2C(C)N1.
What is the InChIKey of 5-chloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine?
The InChIKey is OVCRQVHRSLIVTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN3/c1-6-9-7(11)4-3-5-8(9)14-10(12-2)13-6/h3-6H,1-2H3,(H2,12,13,14).
What are the key properties of 5-chloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine?
5-chloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine has a molecular weight of 209.68 g/mol, XLogP of 2.40, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine is sourced from PubChem (CID 135458392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).