C10H11Cl2N3 — CID 135458394
5,6-dichloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine (PubChem CID 135458394) has the molecular formula C10H11Cl2N3 and a molecular weight of 244.12 g/mol. Its IUPAC name is 5,6-dichloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine.
| Compound Name | 5,6-dichloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine |
|---|---|
| PubChem CID | 135458394 |
| Molecular Formula | C10H11Cl2N3 |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 5,6-dichloro-N,4-dimethyl-3,4-dihydro-1H-quinazolin-2-imine |
| SMILES | C/N=C1/Nc2ccc(Cl)c(Cl)c2C(C)N1 |
| InChI | InChI=1S/C10H11Cl2N3/c1-5-8-7(15-10(13-2)14-5)4-3-6(11)9(8)12/h3-5H,1-2H3,(H2,13,14,15) |
| InChIKey | QZNXPVYAMUSJAD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|