About 4-[(E)-N-[(2,6-diphenylpyrimidin-4-yl)amino]-C-methylcarbonimidoyl]-2-methylphenol
4-[(E)-N-[(2,6-diphenylpyrimidin-4-yl)amino]-C-methylcarbonimidoyl]-2-methylphenol (PubChem CID 135458769) has the molecular formula C25H22N4O
and a molecular weight of 394.48 g/mol. Its IUPAC name is 4-[(E)-N-[(2,6-diphenylpyrimidin-4-yl)amino]-C-methylcarbonimidoyl]-2-methylphenol.
Molecular Properties
| Compound Name | 4-[(E)-N-[(2,6-diphenylpyrimidin-4-yl)amino]-C-methylcarbonimidoyl]-2-methylphenol |
| PubChem CID | 135458769 |
| Molecular Formula | C25H22N4O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 4-[(E)-N-[(2,6-diphenylpyrimidin-4-yl)amino]-C-methylcarbonimidoyl]-2-methylphenol |
| SMILES | C/C(=N\Nc1cc(-c2ccccc2)nc(-c2ccccc2)n1)c1ccc(O)c(C)c1 |
| InChI | InChI=1S/C25H22N4O/c1-17-15-21(13-14-23(17)30)18(2)28-29-24-16-22(19-9-5-3-6-10-19)26-25(27-24)20-11-7-4-8-12-20/h3-16,30H,1-2H3,(H,26,27,29)/b28-18+ |
| InChIKey | PAEZYXGJYVZIDT-MTDXEUNCSA-N |
| XLogP | 5.66 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-N-[(2,6-diphenylpyrimidin-4-yl)amino]-C-methylcarbonimidoyl]-2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-N-[(2,6-diphenylpyrimidin-4-yl)amino]-C-methylcarbonimidoyl]-2-methylphenol?
The IUPAC name of 4-[(E)-N-[(2,6-diphenylpyrimidin-4-yl)amino]-C-methylcarbonimidoyl]-2-methylphenol (CID 135458769) is 4-[(E)-N-[(2,6-diphenylpyrimidin-4-yl)amino]-C-methylcarbonimidoyl]-2-methylphenol.
What is the SMILES notation for 4-[(E)-N-[(2,6-diphenylpyrimidin-4-yl)amino]-C-methylcarbonimidoyl]-2-methylphenol?
The canonical SMILES for 4-[(E)-N-[(2,6-diphenylpyrimidin-4-yl)amino]-C-methylcarbonimidoyl]-2-methylphenol is C/C(=N\Nc1cc(-c2ccccc2)nc(-c2ccccc2)n1)c1ccc(O)c(C)c1.
What is the InChIKey of 4-[(E)-N-[(2,6-diphenylpyrimidin-4-yl)amino]-C-methylcarbonimidoyl]-2-methylphenol?
The InChIKey is PAEZYXGJYVZIDT-MTDXEUNCSA-N. The full InChI is InChI=1S/C25H22N4O/c1-17-15-21(13-14-23(17)30)18(2)28-29-24-16-22(19-9-5-3-6-10-19)26-25(27-24)20-11-7-4-8-12-20/h3-16,30H,1-2H3,(H,26,27,29)/b28-18+.
What are the key properties of 4-[(E)-N-[(2,6-diphenylpyrimidin-4-yl)amino]-C-methylcarbonimidoyl]-2-methylphenol?
4-[(E)-N-[(2,6-diphenylpyrimidin-4-yl)amino]-C-methylcarbonimidoyl]-2-methylphenol has a molecular weight of 394.48 g/mol, XLogP of 5.66, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-N-[(2,6-diphenylpyrimidin-4-yl)amino]-C-methylcarbonimidoyl]-2-methylphenol is sourced from PubChem (CID 135458769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).