About 4-[(E)-1,3-benzothiazol-2-yliminomethyl]phenol
4-[(E)-1,3-benzothiazol-2-yliminomethyl]phenol (PubChem CID 135458943) has the molecular formula C14H10N2OS
and a molecular weight of 254.31 g/mol. Its IUPAC name is 4-[(E)-1,3-benzothiazol-2-yliminomethyl]phenol.
Molecular Properties
| Compound Name | 4-[(E)-1,3-benzothiazol-2-yliminomethyl]phenol |
| PubChem CID | 135458943 |
| Molecular Formula | C14H10N2OS |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 4-[(E)-1,3-benzothiazol-2-yliminomethyl]phenol |
| SMILES | Oc1ccc(/C=N/c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C14H10N2OS/c17-11-7-5-10(6-8-11)9-15-14-16-12-3-1-2-4-13(12)18-14/h1-9,17H/b15-9+ |
| InChIKey | QUOYEPXINAMZHB-OQLLNIDSSA-N |
| XLogP | 3.75 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-1,3-benzothiazol-2-yliminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-1,3-benzothiazol-2-yliminomethyl]phenol?
The IUPAC name of 4-[(E)-1,3-benzothiazol-2-yliminomethyl]phenol (CID 135458943) is 4-[(E)-1,3-benzothiazol-2-yliminomethyl]phenol.
What is the SMILES notation for 4-[(E)-1,3-benzothiazol-2-yliminomethyl]phenol?
The canonical SMILES for 4-[(E)-1,3-benzothiazol-2-yliminomethyl]phenol is Oc1ccc(/C=N/c2nc3ccccc3s2)cc1.
What is the InChIKey of 4-[(E)-1,3-benzothiazol-2-yliminomethyl]phenol?
The InChIKey is QUOYEPXINAMZHB-OQLLNIDSSA-N. The full InChI is InChI=1S/C14H10N2OS/c17-11-7-5-10(6-8-11)9-15-14-16-12-3-1-2-4-13(12)18-14/h1-9,17H/b15-9+.
What are the key properties of 4-[(E)-1,3-benzothiazol-2-yliminomethyl]phenol?
4-[(E)-1,3-benzothiazol-2-yliminomethyl]phenol has a molecular weight of 254.31 g/mol, XLogP of 3.75, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-1,3-benzothiazol-2-yliminomethyl]phenol is sourced from PubChem (CID 135458943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).