C22H19N3O — CID 135459143
7-ethoxy-2,5-diphenyl-3H-1,3,4-benzotriazepine (PubChem CID 135459143) has the molecular formula C22H19N3O and a molecular weight of 341.41 g/mol. Its IUPAC name is 7-ethoxy-2,5-diphenyl-3H-1,3,4-benzotriazepine.
| Compound Name | 7-ethoxy-2,5-diphenyl-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135459143 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 7-ethoxy-2,5-diphenyl-3H-1,3,4-benzotriazepine |
| SMILES | CCOc1ccc2c(c1)C(c1ccccc1)=NNC(c1ccccc1)=N2 |
| InChI | InChI=1S/C22H19N3O/c1-2-26-18-13-14-20-19(15-18)21(16-9-5-3-6-10-16)24-25-22(23-20)17-11-7-4-8-12-17/h3-15H,2H2,1H3,(H,23,25) |
| InChIKey | JAXOWPJPXYASFE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |