About 5-(2-hydroxyethyl)-2,4-dimethyl-1H-pyrimidin-6-one
5-(2-hydroxyethyl)-2,4-dimethyl-1H-pyrimidin-6-one (PubChem CID 135459367) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-2,4-dimethyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-(2-hydroxyethyl)-2,4-dimethyl-1H-pyrimidin-6-one |
| PubChem CID | 135459367 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 5-(2-hydroxyethyl)-2,4-dimethyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(C)c(CCO)c(=O)[nH]1 |
| InChI | InChI=1S/C8H12N2O2/c1-5-7(3-4-11)8(12)10-6(2)9-5/h11H,3-4H2,1-2H3,(H,9,10,12) |
| InChIKey | NWJMOPQMBUDEJB-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2-hydroxyethyl)-2,4-dimethyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-hydroxyethyl)-2,4-dimethyl-1H-pyrimidin-6-one?
The IUPAC name of 5-(2-hydroxyethyl)-2,4-dimethyl-1H-pyrimidin-6-one (CID 135459367) is 5-(2-hydroxyethyl)-2,4-dimethyl-1H-pyrimidin-6-one.
What is the SMILES notation for 5-(2-hydroxyethyl)-2,4-dimethyl-1H-pyrimidin-6-one?
The canonical SMILES for 5-(2-hydroxyethyl)-2,4-dimethyl-1H-pyrimidin-6-one is Cc1nc(C)c(CCO)c(=O)[nH]1.
What is the InChIKey of 5-(2-hydroxyethyl)-2,4-dimethyl-1H-pyrimidin-6-one?
The InChIKey is NWJMOPQMBUDEJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-5-7(3-4-11)8(12)10-6(2)9-5/h11H,3-4H2,1-2H3,(H,9,10,12).
What are the key properties of 5-(2-hydroxyethyl)-2,4-dimethyl-1H-pyrimidin-6-one?
5-(2-hydroxyethyl)-2,4-dimethyl-1H-pyrimidin-6-one has a molecular weight of 168.20 g/mol, XLogP of -0.08, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-hydroxyethyl)-2,4-dimethyl-1H-pyrimidin-6-one is sourced from PubChem (CID 135459367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).