About 6-nitro-3H-1,2,3-benzotriazin-4-one
6-nitro-3H-1,2,3-benzotriazin-4-one (PubChem CID 135459373) has the molecular formula C7H4N4O3
and a molecular weight of 192.13 g/mol. Its IUPAC name is 6-nitro-3H-1,2,3-benzotriazin-4-one.
Molecular Properties
| Compound Name | 6-nitro-3H-1,2,3-benzotriazin-4-one |
| PubChem CID | 135459373 |
| Molecular Formula | C7H4N4O3 |
| Molecular Weight | 192.13 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 6-nitro-3H-1,2,3-benzotriazin-4-one |
| SMILES | O=c1[nH]nnc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C7H4N4O3/c12-7-5-3-4(11(13)14)1-2-6(5)8-10-9-7/h1-3H,(H,8,9,12) |
| InChIKey | HFYBDBPOKYEMJB-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.13 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitro-3H-1,2,3-benzotriazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitro-3H-1,2,3-benzotriazin-4-one?
The IUPAC name of 6-nitro-3H-1,2,3-benzotriazin-4-one (CID 135459373) is 6-nitro-3H-1,2,3-benzotriazin-4-one.
What is the SMILES notation for 6-nitro-3H-1,2,3-benzotriazin-4-one?
The canonical SMILES for 6-nitro-3H-1,2,3-benzotriazin-4-one is O=c1[nH]nnc2ccc([N+](=O)[O-])cc12.
What is the InChIKey of 6-nitro-3H-1,2,3-benzotriazin-4-one?
The InChIKey is HFYBDBPOKYEMJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N4O3/c12-7-5-3-4(11(13)14)1-2-6(5)8-10-9-7/h1-3H,(H,8,9,12).
What are the key properties of 6-nitro-3H-1,2,3-benzotriazin-4-one?
6-nitro-3H-1,2,3-benzotriazin-4-one has a molecular weight of 192.13 g/mol, XLogP of 0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitro-3H-1,2,3-benzotriazin-4-one is sourced from PubChem (CID 135459373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).