About 3-chloro-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one
3-chloro-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one (PubChem CID 135459391) has the molecular formula C5H2ClN3OS
and a molecular weight of 187.61 g/mol. Its IUPAC name is 3-chloro-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-chloro-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 135459391 |
| Molecular Formula | C5H2ClN3OS |
| Molecular Weight | 187.61 g/mol |
| Exact Mass | 186.96 |
| IUPAC Name | 3-chloro-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2snc(Cl)c12 |
| InChI | InChI=1S/C5H2ClN3OS/c6-3-2-4(10)7-1-8-5(2)11-9-3/h1H,(H,7,8,10) |
| InChIKey | DASCKRAHGBTDMD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.61 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 3-chloro-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one (CID 135459391) is 3-chloro-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 3-chloro-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 3-chloro-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one is O=c1[nH]cnc2snc(Cl)c12.
What is the InChIKey of 3-chloro-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one?
The InChIKey is DASCKRAHGBTDMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2ClN3OS/c6-3-2-4(10)7-1-8-5(2)11-9-3/h1H,(H,7,8,10).
What are the key properties of 3-chloro-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one?
3-chloro-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one has a molecular weight of 187.61 g/mol, XLogP of 1.03, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5H-[1,2]thiazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 135459391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).