About 2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one
2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135459529) has the molecular formula C11H12N2OS
and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| PubChem CID | 135459529 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C)cc(/N=C2/NC(=O)CS2)c1 |
| InChI | InChI=1S/C11H12N2OS/c1-7-3-8(2)5-9(4-7)12-11-13-10(14)6-15-11/h3-5H,6H2,1-2H3,(H,12,13,14) |
| InChIKey | RGLCFEXHTFHCCU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one?
The IUPAC name of 2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one (CID 135459529) is 2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one?
The canonical SMILES for 2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one is Cc1cc(C)cc(/N=C2/NC(=O)CS2)c1.
What is the InChIKey of 2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one?
The InChIKey is RGLCFEXHTFHCCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2OS/c1-7-3-8(2)5-9(4-7)12-11-13-10(14)6-15-11/h3-5H,6H2,1-2H3,(H,12,13,14).
What are the key properties of 2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one?
2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one has a molecular weight of 220.30 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one is sourced from PubChem (CID 135459529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).