C12H11BrN4O2 — CID 135459549
4-bromo-N-[(E)-(2-hydroxy-5-methylphenyl)methylideneamino]-1H-pyrazole-5-carboxamide (PubChem CID 135459549) has the molecular formula C12H11BrN4O2 and a molecular weight of 323.15 g/mol. Its IUPAC name is 4-bromo-N-[(E)-(2-hydroxy-5-methylphenyl)methylideneamino]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-bromo-N-[(E)-(2-hydroxy-5-methylphenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 135459549 |
| Molecular Formula | C12H11BrN4O2 |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 4-bromo-N-[(E)-(2-hydroxy-5-methylphenyl)methylideneamino]-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc(O)c(/C=N/NC(=O)c2[nH]ncc2Br)c1 |
| InChI | InChI=1S/C12H11BrN4O2/c1-7-2-3-10(18)8(4-7)5-14-17-12(19)11-9(13)6-15-16-11/h2-6,18H,1H3,(H,15,16)(H,17,19)/b14-5+ |
| InChIKey | RVNCSNANHTUCQA-LHHJGKSTSA-N |
| XLogP | 1.95 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|