C10H17N4O+ — CID 135459602
2-(1,4-diazepan-4-ium-1-yl)-4-methyl-1H-pyrimidin-6-one (PubChem CID 135459602) has the molecular formula C10H17N4O+ and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-(1,4-diazepan-4-ium-1-yl)-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-(1,4-diazepan-4-ium-1-yl)-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135459602 |
| Molecular Formula | C10H17N4O+ |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2-(1,4-diazepan-4-ium-1-yl)-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(N2CCC[NH2+]CC2)n1 |
| InChI | InChI=1S/C10H16N4O/c1-8-7-9(15)13-10(12-8)14-5-2-3-11-4-6-14/h7,11H,2-6H2,1H3,(H,12,13,15)/p+1 |
| InChIKey | CZZGTZUJBSXVLV-UHFFFAOYSA-O |
| XLogP | -1.15 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |