C26H28CuN2O4 — CID 135459890
copper;5-[2-[(4,6-dihydroxy-6-phenylhexa-3,5-dien-2-ylidene)amino]ethylimino]-1-phenylhexa-1,3-diene-1,3-diol (PubChem CID 135459890) has the molecular formula C26H28CuN2O4 and a molecular weight of 496.07 g/mol. Its IUPAC name is copper;5-[2-[(4,6-dihydroxy-6-phenylhexa-3,5-dien-2-ylidene)amino]ethylimino]-1-phenylhexa-1,3-diene-1,3-diol.
| Compound Name | copper;5-[2-[(4,6-dihydroxy-6-phenylhexa-3,5-dien-2-ylidene)amino]ethylimino]-1-phenylhexa-1,3-diene-1,3-diol |
|---|---|
| PubChem CID | 135459890 |
| Molecular Formula | C26H28CuN2O4 |
| Molecular Weight | 496.07 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | copper;5-[2-[(4,6-dihydroxy-6-phenylhexa-3,5-dien-2-ylidene)amino]ethylimino]-1-phenylhexa-1,3-diene-1,3-diol |
| SMILES | C/C(C=C(O)C=C(O)c1ccccc1)=N/CC/N=C(/C)C=C(O)C=C(O)c1ccccc1.[Cu] |
| InChI | InChI=1S/C26H28N2O4.Cu/c1-19(15-23(29)17-25(31)21-9-5-3-6-10-21)27-13-14-28-20(2)16-24(30)18-26(32)22-11-7-4-8-12-22;/h3-12,15-18,29-32H,13-14H2,1-2H3;/b23-15?,24-16?,25-17?,26-18?,27-19-,28-20-; |
| InChIKey | JZAHSDJZVVCSFF-VQDOCTEVSA-N |
| XLogP | 5.99 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.07 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|