C16H20N2 — CID 135460000
2-(3aH-inden-1-yl)-1,3,4,5-tetramethyl-2H-imidazole (PubChem CID 135460000) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-(3aH-inden-1-yl)-1,3,4,5-tetramethyl-2H-imidazole.
| Compound Name | 2-(3aH-inden-1-yl)-1,3,4,5-tetramethyl-2H-imidazole |
|---|---|
| PubChem CID | 135460000 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 2-(3aH-inden-1-yl)-1,3,4,5-tetramethyl-2H-imidazole |
| SMILES | CC1=C(C)N(C)C(C2=C3C=CC=CC3C=C2)N1C |
| InChI | InChI=1S/C16H20N2/c1-11-12(2)18(4)16(17(11)3)15-10-9-13-7-5-6-8-14(13)15/h5-10,13,16H,1-4H3 |
| InChIKey | YBIQQXFZXVLJAE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |