C40H52N2O4 — CID 135460180
2-(1-hydroxypentylidene)-3-[6-[[2-(1-hydroxypentylidene)-3-oxo-5-phenylcyclohexylidene]amino]hexylimino]-5-phenylcyclohexan-1-one (PubChem CID 135460180) has the molecular formula C40H52N2O4 and a molecular weight of 624.87 g/mol. Its IUPAC name is 2-(1-hydroxypentylidene)-3-[6-[[2-(1-hydroxypentylidene)-3-oxo-5-phenylcyclohexylidene]amino]hexylimino]-5-phenylcyclohexan-1-one.
| Compound Name | 2-(1-hydroxypentylidene)-3-[6-[[2-(1-hydroxypentylidene)-3-oxo-5-phenylcyclohexylidene]amino]hexylimino]-5-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 135460180 |
| Molecular Formula | C40H52N2O4 |
| Molecular Weight | 624.87 g/mol |
| Exact Mass | 624.39 |
| IUPAC Name | 2-(1-hydroxypentylidene)-3-[6-[[2-(1-hydroxypentylidene)-3-oxo-5-phenylcyclohexylidene]amino]hexylimino]-5-phenylcyclohexan-1-one |
| SMILES | CCCCC(O)=C1C(=O)CC(c2ccccc2)C/C1=N\CCCCCC/N=C1\CC(c2ccccc2)CC(=O)C1=C(O)CCCC |
| InChI | InChI=1S/C40H52N2O4/c1-3-5-21-35(43)39-33(25-31(27-37(39)45)29-17-11-9-12-18-29)41-23-15-7-8-16-24-42-34-26-32(30-19-13-10-14-20-30)28-38(46)40(34)36(44)22-6-4-2/h9-14,17-20,31-32,43-44H,3-8,15-16,21-28H2,1-2H3/b39-35?,40-36?,41-33+,42-34+ |
| InChIKey | ULUORSDETOCMRW-DZZFEJMPSA-N |
| XLogP | 9.73 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.87 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|