C11H9N3O — CID 135460475
4-methyl-1H-pyrimido[1,2-b]indazol-2-one (PubChem CID 135460475) has the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. Its IUPAC name is 4-methyl-1H-pyrimido[1,2-b]indazol-2-one.
| Compound Name | 4-methyl-1H-pyrimido[1,2-b]indazol-2-one |
|---|---|
| PubChem CID | 135460475 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 4-methyl-1H-pyrimido[1,2-b]indazol-2-one |
| SMILES | Cc1cc(=O)[nH]c2c3ccccc3nn12 |
| InChI | InChI=1S/C11H9N3O/c1-7-6-10(15)12-11-8-4-2-3-5-9(8)13-14(7)11/h2-6H,1H3,(H,12,15) |
| InChIKey | CBYHAQUILDBZNF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |