About 2,4-dimethyl-1H-pyrido[3,2-b]carbazol-9-ol
2,4-dimethyl-1H-pyrido[3,2-b]carbazol-9-ol (PubChem CID 135460739) has the molecular formula C17H14N2O
and a molecular weight of 262.31 g/mol. Its IUPAC name is 2,4-dimethyl-1H-pyrido[3,2-b]carbazol-9-ol.
Molecular Properties
| Compound Name | 2,4-dimethyl-1H-pyrido[3,2-b]carbazol-9-ol |
| PubChem CID | 135460739 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2,4-dimethyl-1H-pyrido[3,2-b]carbazol-9-ol |
| SMILES | Cc1cc(C)c2cc3nc4ccc(O)cc4c3cc2[nH]1 |
| InChI | InChI=1S/C17H14N2O/c1-9-5-10(2)18-16-8-14-13-6-11(20)3-4-15(13)19-17(14)7-12(9)16/h3-8,18,20H,1-2H3 |
| InChIKey | RRUPBWHIWSFQDX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethyl-1H-pyrido[3,2-b]carbazol-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1H-pyrido[3,2-b]carbazol-9-ol?
The IUPAC name of 2,4-dimethyl-1H-pyrido[3,2-b]carbazol-9-ol (CID 135460739) is 2,4-dimethyl-1H-pyrido[3,2-b]carbazol-9-ol.
What is the SMILES notation for 2,4-dimethyl-1H-pyrido[3,2-b]carbazol-9-ol?
The canonical SMILES for 2,4-dimethyl-1H-pyrido[3,2-b]carbazol-9-ol is Cc1cc(C)c2cc3nc4ccc(O)cc4c3cc2[nH]1.
What is the InChIKey of 2,4-dimethyl-1H-pyrido[3,2-b]carbazol-9-ol?
The InChIKey is RRUPBWHIWSFQDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O/c1-9-5-10(2)18-16-8-14-13-6-11(20)3-4-15(13)19-17(14)7-12(9)16/h3-8,18,20H,1-2H3.
What are the key properties of 2,4-dimethyl-1H-pyrido[3,2-b]carbazol-9-ol?
2,4-dimethyl-1H-pyrido[3,2-b]carbazol-9-ol has a molecular weight of 262.31 g/mol, XLogP of 4.19, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1H-pyrido[3,2-b]carbazol-9-ol is sourced from PubChem (CID 135460739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).