About 3-acetyl-4,8-dihydroxy-2-iminonaphthalen-1-one
3-acetyl-4,8-dihydroxy-2-iminonaphthalen-1-one (PubChem CID 135460765) has the molecular formula C12H9NO4
and a molecular weight of 231.21 g/mol. Its IUPAC name is 3-acetyl-4,8-dihydroxy-2-iminonaphthalen-1-one.
Molecular Properties
| Compound Name | 3-acetyl-4,8-dihydroxy-2-iminonaphthalen-1-one |
| PubChem CID | 135460765 |
| Molecular Formula | C12H9NO4 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 3-acetyl-4,8-dihydroxy-2-iminonaphthalen-1-one |
| SMILES | [H]/N=C1\C(=O)c2c(O)cccc2C(O)=C1C(C)=O |
| InChI | InChI=1S/C12H9NO4/c1-5(14)8-10(13)12(17)9-6(11(8)16)3-2-4-7(9)15/h2-4,13,15-16H,1H3/b13-10- |
| InChIKey | YLRHQZPXMKMCAM-RAXLEYEMSA-N |
| XLogP | 1.47 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-4,8-dihydroxy-2-iminonaphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-4,8-dihydroxy-2-iminonaphthalen-1-one?
The IUPAC name of 3-acetyl-4,8-dihydroxy-2-iminonaphthalen-1-one (CID 135460765) is 3-acetyl-4,8-dihydroxy-2-iminonaphthalen-1-one.
What is the SMILES notation for 3-acetyl-4,8-dihydroxy-2-iminonaphthalen-1-one?
The canonical SMILES for 3-acetyl-4,8-dihydroxy-2-iminonaphthalen-1-one is [H]/N=C1\C(=O)c2c(O)cccc2C(O)=C1C(C)=O.
What is the InChIKey of 3-acetyl-4,8-dihydroxy-2-iminonaphthalen-1-one?
The InChIKey is YLRHQZPXMKMCAM-RAXLEYEMSA-N. The full InChI is InChI=1S/C12H9NO4/c1-5(14)8-10(13)12(17)9-6(11(8)16)3-2-4-7(9)15/h2-4,13,15-16H,1H3/b13-10-.
What are the key properties of 3-acetyl-4,8-dihydroxy-2-iminonaphthalen-1-one?
3-acetyl-4,8-dihydroxy-2-iminonaphthalen-1-one has a molecular weight of 231.21 g/mol, XLogP of 1.47, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-4,8-dihydroxy-2-iminonaphthalen-1-one is sourced from PubChem (CID 135460765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).