C10H16N2O2 — CID 135460880
N-(3-hydroxyimino-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-ylidene)hydroxylamine (PubChem CID 135460880) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is N-(3-hydroxyimino-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-ylidene)hydroxylamine.
| Compound Name | N-(3-hydroxyimino-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 135460880 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | N-(3-hydroxyimino-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-ylidene)hydroxylamine |
| SMILES | ON=C1CC2CCCCC2CC1=NO |
| InChI | InChI=1S/C10H16N2O2/c13-11-9-5-7-3-1-2-4-8(7)6-10(9)12-14/h7-8,13-14H,1-6H2 |
| InChIKey | RCHRHPOKTAVMAL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|