C9H10N4O3 — CID 135460927
2-[(1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)amino]ethanol (PubChem CID 135460927) has the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. Its IUPAC name is 2-[(1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)amino]ethanol.
| Compound Name | 2-[(1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)amino]ethanol |
|---|---|
| PubChem CID | 135460927 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-[(1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)amino]ethanol |
| SMILES | [O-][n+]1nc(NCCO)[n+]([O-])c2ccccc21 |
| InChI | InChI=1S/C9H10N4O3/c14-6-5-10-9-11-13(16)8-4-2-1-3-7(8)12(9)15/h1-4,14H,5-6H2,(H,10,11) |
| InChIKey | JHFOHYDCOTVHDH-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|