About 3-(4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)propanoic acid
3-(4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)propanoic acid (PubChem CID 135461011) has the molecular formula C8H8N4O3
and a molecular weight of 208.18 g/mol. Its IUPAC name is 3-(4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)propanoic acid |
| PubChem CID | 135461011 |
| Molecular Formula | C8H8N4O3 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 3-(4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)propanoic acid |
| SMILES | O=C(O)CCn1ncc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C8H8N4O3/c13-6(14)1-2-12-7-5(3-11-12)8(15)10-4-9-7/h3-4H,1-2H2,(H,13,14)(H,9,10,15) |
| InChIKey | RFLJNURDYJSWRK-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)propanoic acid?
The IUPAC name of 3-(4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)propanoic acid (CID 135461011) is 3-(4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)propanoic acid.
What is the SMILES notation for 3-(4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)propanoic acid?
The canonical SMILES for 3-(4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)propanoic acid is O=C(O)CCn1ncc2c(=O)[nH]cnc21.
What is the InChIKey of 3-(4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)propanoic acid?
The InChIKey is RFLJNURDYJSWRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O3/c13-6(14)1-2-12-7-5(3-11-12)8(15)10-4-9-7/h3-4H,1-2H2,(H,13,14)(H,9,10,15).
What are the key properties of 3-(4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)propanoic acid?
3-(4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)propanoic acid has a molecular weight of 208.18 g/mol, XLogP of -0.41, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-oxo-5H-pyrazolo[5,4-d]pyrimidin-1-yl)propanoic acid is sourced from PubChem (CID 135461011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).