About 4-(1,4,5-triphenylimidazol-2-yl)phenol
4-(1,4,5-triphenylimidazol-2-yl)phenol (PubChem CID 135461036) has the molecular formula C27H20N2O
and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-(1,4,5-triphenylimidazol-2-yl)phenol.
Molecular Properties
| Compound Name | 4-(1,4,5-triphenylimidazol-2-yl)phenol |
| PubChem CID | 135461036 |
| Molecular Formula | C27H20N2O |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 4-(1,4,5-triphenylimidazol-2-yl)phenol |
| SMILES | Oc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H20N2O/c30-24-18-16-22(17-19-24)27-28-25(20-10-4-1-5-11-20)26(21-12-6-2-7-13-21)29(27)23-14-8-3-9-15-23/h1-19,30H |
| InChIKey | GCKCWYDVTWNXAX-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,4,5-triphenylimidazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,4,5-triphenylimidazol-2-yl)phenol?
The IUPAC name of 4-(1,4,5-triphenylimidazol-2-yl)phenol (CID 135461036) is 4-(1,4,5-triphenylimidazol-2-yl)phenol.
What is the SMILES notation for 4-(1,4,5-triphenylimidazol-2-yl)phenol?
The canonical SMILES for 4-(1,4,5-triphenylimidazol-2-yl)phenol is Oc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)n2-c2ccccc2)cc1.
What is the InChIKey of 4-(1,4,5-triphenylimidazol-2-yl)phenol?
The InChIKey is GCKCWYDVTWNXAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20N2O/c30-24-18-16-22(17-19-24)27-28-25(20-10-4-1-5-11-20)26(21-12-6-2-7-13-21)29(27)23-14-8-3-9-15-23/h1-19,30H.
What are the key properties of 4-(1,4,5-triphenylimidazol-2-yl)phenol?
4-(1,4,5-triphenylimidazol-2-yl)phenol has a molecular weight of 388.47 g/mol, XLogP of 6.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4,5-triphenylimidazol-2-yl)phenol is sourced from PubChem (CID 135461036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).