C25H30FN5O2 — CID 135461278
2-amino-N-[3-(dimethylamino)propyl]-6-[5-(2-fluoro-N,4-dimethylanilino)-2-hydroxyphenyl]pyridine-3-carboxamide (PubChem CID 135461278) has the molecular formula C25H30FN5O2 and a molecular weight of 451.55 g/mol. Its IUPAC name is 2-amino-N-[3-(dimethylamino)propyl]-6-[5-(2-fluoro-N,4-dimethylanilino)-2-hydroxyphenyl]pyridine-3-carboxamide.
| Compound Name | 2-amino-N-[3-(dimethylamino)propyl]-6-[5-(2-fluoro-N,4-dimethylanilino)-2-hydroxyphenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135461278 |
| Molecular Formula | C25H30FN5O2 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 2-amino-N-[3-(dimethylamino)propyl]-6-[5-(2-fluoro-N,4-dimethylanilino)-2-hydroxyphenyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(N(C)c2ccc(O)c(-c3ccc(C(=O)NCCCN(C)C)c(N)n3)c2)c(F)c1 |
| InChI | InChI=1S/C25H30FN5O2/c1-16-6-10-22(20(26)14-16)31(4)17-7-11-23(32)19(15-17)21-9-8-18(24(27)29-21)25(33)28-12-5-13-30(2)3/h6-11,14-15,32H,5,12-13H2,1-4H3,(H2,27,29)(H,28,33) |
| InChIKey | PSGSJOPUBGHAJL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|