C22H21N3O2S — CID 135461539
7-methoxy-5-(4-propoxyphenyl)-2-thiophen-2-yl-3H-1,3,4-benzotriazepine (PubChem CID 135461539) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 7-methoxy-5-(4-propoxyphenyl)-2-thiophen-2-yl-3H-1,3,4-benzotriazepine.
| Compound Name | 7-methoxy-5-(4-propoxyphenyl)-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135461539 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 7-methoxy-5-(4-propoxyphenyl)-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
| SMILES | CCCOc1ccc(C2=NNC(c3cccs3)=Nc3ccc(OC)cc32)cc1 |
| InChI | InChI=1S/C22H21N3O2S/c1-3-12-27-16-8-6-15(7-9-16)21-18-14-17(26-2)10-11-19(18)23-22(25-24-21)20-5-4-13-28-20/h4-11,13-14H,3,12H2,1-2H3,(H,23,25) |
| InChIKey | XCICUNIOYMYJIM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |