About 3-[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]propanoic acid
3-[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]propanoic acid (PubChem CID 135461677) has the molecular formula C12H13NO3S
and a molecular weight of 251.31 g/mol. Its IUPAC name is 3-[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]propanoic acid |
| PubChem CID | 135461677 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 3-[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]propanoic acid |
| SMILES | O=C(O)CC[C@H]1CSC(c2ccccc2O)=N1 |
| InChI | InChI=1S/C12H13NO3S/c14-10-4-2-1-3-9(10)12-13-8(7-17-12)5-6-11(15)16/h1-4,8,14H,5-7H2,(H,15,16)/t8-/m0/s1 |
| InChIKey | MJQQTANRQAKZEZ-QMMMGPOBSA-N |
| XLogP | 2.12 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]propanoic acid?
The IUPAC name of 3-[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]propanoic acid (CID 135461677) is 3-[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]propanoic acid.
What is the SMILES notation for 3-[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]propanoic acid?
The canonical SMILES for 3-[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]propanoic acid is O=C(O)CC[C@H]1CSC(c2ccccc2O)=N1.
What is the InChIKey of 3-[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]propanoic acid?
The InChIKey is MJQQTANRQAKZEZ-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H13NO3S/c14-10-4-2-1-3-9(10)12-13-8(7-17-12)5-6-11(15)16/h1-4,8,14H,5-7H2,(H,15,16)/t8-/m0/s1.
What are the key properties of 3-[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]propanoic acid?
3-[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]propanoic acid has a molecular weight of 251.31 g/mol, XLogP of 2.12, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]propanoic acid is sourced from PubChem (CID 135461677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).