About CID 135462429
CID 135462429 (PubChem CID 135462429) has the molecular formula C29H19N5O2
and a molecular weight of 469.50 g/mol.
Molecular Properties
| Compound Name | CID 135462429 |
| PubChem CID | 135462429 |
| Molecular Formula | C29H19N5O2 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | — |
| SMILES | O=C1NC2=NNC3(C(=O)N2NC12c1ccccc1-c1ccccc12)c1ccccc1-c1ccccc13 |
| InChI | InChI=1S/C29H19N5O2/c35-25-28(21-13-5-1-9-17(21)18-10-2-6-14-22(18)28)33-34-26(36)29(32-31-27(34)30-25)23-15-7-3-11-19(23)20-12-4-8-16-24(20)29/h1-16,32-33H,(H,30,31,35) |
| InChIKey | VIQSSQOIVAXHBO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 135462429 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135462429?
The IUPAC name of CID 135462429 (CID 135462429) is not available.
What is the SMILES notation for CID 135462429?
The canonical SMILES for CID 135462429 is O=C1NC2=NNC3(C(=O)N2NC12c1ccccc1-c1ccccc12)c1ccccc1-c1ccccc13.
What is the InChIKey of CID 135462429?
The InChIKey is VIQSSQOIVAXHBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H19N5O2/c35-25-28(21-13-5-1-9-17(21)18-10-2-6-14-22(18)28)33-34-26(36)29(32-31-27(34)30-25)23-15-7-3-11-19(23)20-12-4-8-16-24(20)29/h1-16,32-33H,(H,30,31,35).
What are the key properties of CID 135462429?
CID 135462429 has a molecular weight of 469.50 g/mol, XLogP of 3.17, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135462429 is sourced from PubChem (CID 135462429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).