About 3-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-4-hydroxypent-3-en-2-one
3-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-4-hydroxypent-3-en-2-one (PubChem CID 135462570) has the molecular formula C8H10N4O3
and a molecular weight of 210.19 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-4-hydroxypent-3-en-2-one.
Molecular Properties
| Compound Name | 3-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-4-hydroxypent-3-en-2-one |
| PubChem CID | 135462570 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-4-hydroxypent-3-en-2-one |
| SMILES | [H]/N=C(\C(C(C)=O)=C(C)O)c1nonc1N |
| InChI | InChI=1S/C8H10N4O3/c1-3(13)5(4(2)14)6(9)7-8(10)12-15-11-7/h9,13H,1-2H3,(H2,10,12)/b5-3?,9-6+ |
| InChIKey | LYRWBGQRKOMQGE-CIHUCNEJSA-N |
| XLogP | 0.44 |
| TPSA | 126.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-4-hydroxypent-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-4-hydroxypent-3-en-2-one?
The IUPAC name of 3-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-4-hydroxypent-3-en-2-one (CID 135462570) is 3-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-4-hydroxypent-3-en-2-one.
What is the SMILES notation for 3-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-4-hydroxypent-3-en-2-one?
The canonical SMILES for 3-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-4-hydroxypent-3-en-2-one is [H]/N=C(\C(C(C)=O)=C(C)O)c1nonc1N.
What is the InChIKey of 3-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-4-hydroxypent-3-en-2-one?
The InChIKey is LYRWBGQRKOMQGE-CIHUCNEJSA-N. The full InChI is InChI=1S/C8H10N4O3/c1-3(13)5(4(2)14)6(9)7-8(10)12-15-11-7/h9,13H,1-2H3,(H2,10,12)/b5-3?,9-6+.
What are the key properties of 3-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-4-hydroxypent-3-en-2-one?
3-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-4-hydroxypent-3-en-2-one has a molecular weight of 210.19 g/mol, XLogP of 0.44, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-amino-1,2,5-oxadiazole-3-carboximidoyl)-4-hydroxypent-3-en-2-one is sourced from PubChem (CID 135462570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).