C9H14N4O3 — CID 135462583
6-(1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one (PubChem CID 135462583) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 6-(1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one.
| Compound Name | 6-(1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135462583 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 6-(1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one |
| SMILES | CC(O)C(O)C1CNc2nc[nH]c(=O)c2N1 |
| InChI | InChI=1S/C9H14N4O3/c1-4(14)7(15)5-2-10-8-6(13-5)9(16)12-3-11-8/h3-5,7,13-15H,2H2,1H3,(H2,10,11,12,16) |
| InChIKey | XHZMOKNFPZDZBZ-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |