About N-(3-hydroxyimino-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine
N-(3-hydroxyimino-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine (PubChem CID 135462656) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is N-(3-hydroxyimino-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine.
Molecular Properties
| Compound Name | N-(3-hydroxyimino-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine |
| PubChem CID | 135462656 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | N-(3-hydroxyimino-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine |
| SMILES | CC12CCC(C(=NO)C1=NO)C2(C)C |
| InChI | InChI=1S/C10H16N2O2/c1-9(2)6-4-5-10(9,3)8(12-14)7(6)11-13/h6,13-14H,4-5H2,1-3H3 |
| InChIKey | JCFJSQZXNOMXCP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-hydroxyimino-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxyimino-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine?
The IUPAC name of N-(3-hydroxyimino-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine (CID 135462656) is N-(3-hydroxyimino-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine.
What is the SMILES notation for N-(3-hydroxyimino-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine?
The canonical SMILES for N-(3-hydroxyimino-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine is CC12CCC(C(=NO)C1=NO)C2(C)C.
What is the InChIKey of N-(3-hydroxyimino-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine?
The InChIKey is JCFJSQZXNOMXCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-9(2)6-4-5-10(9,3)8(12-14)7(6)11-13/h6,13-14H,4-5H2,1-3H3.
What are the key properties of N-(3-hydroxyimino-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine?
N-(3-hydroxyimino-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine has a molecular weight of 196.25 g/mol, XLogP of 2.10, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxyimino-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydroxylamine is sourced from PubChem (CID 135462656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).