C29H26N6O2 — CID 135462769
3-benzyl-5-[1-(4-phenylbenzoyl)piperidin-3-yl]-6H-triazolo[4,5-d]pyrimidin-7-one (PubChem CID 135462769) has the molecular formula C29H26N6O2 and a molecular weight of 490.57 g/mol. Its IUPAC name is 3-benzyl-5-[1-(4-phenylbenzoyl)piperidin-3-yl]-6H-triazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 3-benzyl-5-[1-(4-phenylbenzoyl)piperidin-3-yl]-6H-triazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 135462769 |
| Molecular Formula | C29H26N6O2 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 3-benzyl-5-[1-(4-phenylbenzoyl)piperidin-3-yl]-6H-triazolo[4,5-d]pyrimidin-7-one |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)N1CCCC(c2nc3c(nnn3Cc3ccccc3)c(=O)[nH]2)C1 |
| InChI | InChI=1S/C29H26N6O2/c36-28-25-27(35(33-32-25)18-20-8-3-1-4-9-20)30-26(31-28)24-12-7-17-34(19-24)29(37)23-15-13-22(14-16-23)21-10-5-2-6-11-21/h1-6,8-11,13-16,24H,7,12,17-19H2,(H,30,31,36) |
| InChIKey | KYBJTQCLXLTIAE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |