About N-(7-bromo-5-hydroxy-2,1,3-benzoxadiazol-4-yl)acetamide
N-(7-bromo-5-hydroxy-2,1,3-benzoxadiazol-4-yl)acetamide (PubChem CID 135463061) has the molecular formula C8H6BrN3O3
and a molecular weight of 272.06 g/mol. Its IUPAC name is N-(7-bromo-5-hydroxy-2,1,3-benzoxadiazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-(7-bromo-5-hydroxy-2,1,3-benzoxadiazol-4-yl)acetamide |
| PubChem CID | 135463061 |
| Molecular Formula | C8H6BrN3O3 |
| Molecular Weight | 272.06 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | N-(7-bromo-5-hydroxy-2,1,3-benzoxadiazol-4-yl)acetamide |
| SMILES | CC(=O)Nc1c(O)cc(Br)c2nonc12 |
| InChI | InChI=1S/C8H6BrN3O3/c1-3(13)10-7-5(14)2-4(9)6-8(7)12-15-11-6/h2,14H,1H3,(H,10,13) |
| InChIKey | BPEAUCQHFNJRES-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.06 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-(7-bromo-5-hydroxy-2,1,3-benzoxadiazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-bromo-5-hydroxy-2,1,3-benzoxadiazol-4-yl)acetamide?
The IUPAC name of N-(7-bromo-5-hydroxy-2,1,3-benzoxadiazol-4-yl)acetamide (CID 135463061) is N-(7-bromo-5-hydroxy-2,1,3-benzoxadiazol-4-yl)acetamide.
What is the SMILES notation for N-(7-bromo-5-hydroxy-2,1,3-benzoxadiazol-4-yl)acetamide?
The canonical SMILES for N-(7-bromo-5-hydroxy-2,1,3-benzoxadiazol-4-yl)acetamide is CC(=O)Nc1c(O)cc(Br)c2nonc12.
What is the InChIKey of N-(7-bromo-5-hydroxy-2,1,3-benzoxadiazol-4-yl)acetamide?
The InChIKey is BPEAUCQHFNJRES-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrN3O3/c1-3(13)10-7-5(14)2-4(9)6-8(7)12-15-11-6/h2,14H,1H3,(H,10,13).
What are the key properties of N-(7-bromo-5-hydroxy-2,1,3-benzoxadiazol-4-yl)acetamide?
N-(7-bromo-5-hydroxy-2,1,3-benzoxadiazol-4-yl)acetamide has a molecular weight of 272.06 g/mol, XLogP of 1.65, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-bromo-5-hydroxy-2,1,3-benzoxadiazol-4-yl)acetamide is sourced from PubChem (CID 135463061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).