About phenacyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate
phenacyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate (PubChem CID 135463405) has the molecular formula C19H18N2O5S
and a molecular weight of 386.43 g/mol. Its IUPAC name is phenacyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate.
Molecular Properties
| Compound Name | phenacyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate |
| PubChem CID | 135463405 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | phenacyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate |
| SMILES | O=C(CCC/N=C1\NS(=O)(=O)c2ccccc21)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18N2O5S/c22-16(14-7-2-1-3-8-14)13-26-18(23)11-6-12-20-19-15-9-4-5-10-17(15)27(24,25)21-19/h1-5,7-10H,6,11-13H2,(H,20,21) |
| InChIKey | HAPRLBHFIHOWED-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze phenacyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate?
The IUPAC name of phenacyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate (CID 135463405) is phenacyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate.
What is the SMILES notation for phenacyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate?
The canonical SMILES for phenacyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate is O=C(CCC/N=C1\NS(=O)(=O)c2ccccc21)OCC(=O)c1ccccc1.
What is the InChIKey of phenacyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate?
The InChIKey is HAPRLBHFIHOWED-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O5S/c22-16(14-7-2-1-3-8-14)13-26-18(23)11-6-12-20-19-15-9-4-5-10-17(15)27(24,25)21-19/h1-5,7-10H,6,11-13H2,(H,20,21).
What are the key properties of phenacyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate?
phenacyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate has a molecular weight of 386.43 g/mol, XLogP of 1.93, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl 4-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]butanoate is sourced from PubChem (CID 135463405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).