C16H16N2O4 — CID 135463693
(1E,4E)-1,4-bis(methoxyimino)-2,3-dihydroanthracene-9,10-diol (PubChem CID 135463693) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is (1E,4E)-1,4-bis(methoxyimino)-2,3-dihydroanthracene-9,10-diol.
| Compound Name | (1E,4E)-1,4-bis(methoxyimino)-2,3-dihydroanthracene-9,10-diol |
|---|---|
| PubChem CID | 135463693 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (1E,4E)-1,4-bis(methoxyimino)-2,3-dihydroanthracene-9,10-diol |
| SMILES | CO/N=C1\CC/C(=N\OC)c2c1c(O)c1ccccc1c2O |
| InChI | InChI=1S/C16H16N2O4/c1-21-17-11-7-8-12(18-22-2)14-13(11)15(19)9-5-3-4-6-10(9)16(14)20/h3-6,19-20H,7-8H2,1-2H3/b17-11+,18-12+ |
| InChIKey | ZXHYFQQCSQNJMW-JYFOCSDGSA-N |
| XLogP | 2.75 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|