C18H13NO4 — CID 135463711
11-imino-2-methylbenzo[b]fluorene-4,5,9,10-tetrol (PubChem CID 135463711) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is 11-imino-2-methylbenzo[b]fluorene-4,5,9,10-tetrol.
| Compound Name | 11-imino-2-methylbenzo[b]fluorene-4,5,9,10-tetrol |
|---|---|
| PubChem CID | 135463711 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 11-imino-2-methylbenzo[b]fluorene-4,5,9,10-tetrol |
| SMILES | [H]/N=C1\c2cc(C)cc(O)c2-c2c1c(O)c1c(O)cccc1c2O |
| InChI | InChI=1S/C18H13NO4/c1-7-5-9-12(11(21)6-7)14-15(16(9)19)18(23)13-8(17(14)22)3-2-4-10(13)20/h2-6,19-23H,1H3/b19-16+ |
| InChIKey | NRCYLVCOQBWFLG-KNTRCKAVSA-N |
| XLogP | 3.37 |
| TPSA | 104.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|