C23H25N3O4S — CID 135464032
2-(4-methoxyphenyl)-6-(2,4,6-trimethylphenyl)sulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135464032) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-6-(2,4,6-trimethylphenyl)sulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-methoxyphenyl)-6-(2,4,6-trimethylphenyl)sulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135464032 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2-(4-methoxyphenyl)-6-(2,4,6-trimethylphenyl)sulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | COc1ccc(-c2nc3c(c(=O)[nH]2)CN(S(=O)(=O)c2c(C)cc(C)cc2C)CC3)cc1 |
| InChI | InChI=1S/C23H25N3O4S/c1-14-11-15(2)21(16(3)12-14)31(28,29)26-10-9-20-19(13-26)23(27)25-22(24-20)17-5-7-18(30-4)8-6-17/h5-8,11-12H,9-10,13H2,1-4H3,(H,24,25,27) |
| InChIKey | AXZVGIZEAUOGSG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |