About 2-[5-amino-5-(2-hydroxyphenyl)-1,2,4-dithiazol-3-yl]phenol
2-[5-amino-5-(2-hydroxyphenyl)-1,2,4-dithiazol-3-yl]phenol (PubChem CID 135464116) has the molecular formula C14H12N2O2S2
and a molecular weight of 304.40 g/mol. Its IUPAC name is 2-[5-amino-5-(2-hydroxyphenyl)-1,2,4-dithiazol-3-yl]phenol.
Molecular Properties
| Compound Name | 2-[5-amino-5-(2-hydroxyphenyl)-1,2,4-dithiazol-3-yl]phenol |
| PubChem CID | 135464116 |
| Molecular Formula | C14H12N2O2S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2-[5-amino-5-(2-hydroxyphenyl)-1,2,4-dithiazol-3-yl]phenol |
| SMILES | NC1(c2ccccc2O)N=C(c2ccccc2O)SS1 |
| InChI | InChI=1S/C14H12N2O2S2/c15-14(10-6-2-4-8-12(10)18)16-13(19-20-14)9-5-1-3-7-11(9)17/h1-8,17-18H,15H2 |
| InChIKey | CCIJWABGUMMCMY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-amino-5-(2-hydroxyphenyl)-1,2,4-dithiazol-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-amino-5-(2-hydroxyphenyl)-1,2,4-dithiazol-3-yl]phenol?
The IUPAC name of 2-[5-amino-5-(2-hydroxyphenyl)-1,2,4-dithiazol-3-yl]phenol (CID 135464116) is 2-[5-amino-5-(2-hydroxyphenyl)-1,2,4-dithiazol-3-yl]phenol.
What is the SMILES notation for 2-[5-amino-5-(2-hydroxyphenyl)-1,2,4-dithiazol-3-yl]phenol?
The canonical SMILES for 2-[5-amino-5-(2-hydroxyphenyl)-1,2,4-dithiazol-3-yl]phenol is NC1(c2ccccc2O)N=C(c2ccccc2O)SS1.
What is the InChIKey of 2-[5-amino-5-(2-hydroxyphenyl)-1,2,4-dithiazol-3-yl]phenol?
The InChIKey is CCIJWABGUMMCMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2S2/c15-14(10-6-2-4-8-12(10)18)16-13(19-20-14)9-5-1-3-7-11(9)17/h1-8,17-18H,15H2.
What are the key properties of 2-[5-amino-5-(2-hydroxyphenyl)-1,2,4-dithiazol-3-yl]phenol?
2-[5-amino-5-(2-hydroxyphenyl)-1,2,4-dithiazol-3-yl]phenol has a molecular weight of 304.40 g/mol, XLogP of 3.01, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-amino-5-(2-hydroxyphenyl)-1,2,4-dithiazol-3-yl]phenol is sourced from PubChem (CID 135464116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).